N-(4-Methoxybenzyl)methamphetamine
N-[(4-Methoxyphenyl)methyl]-N-methyl-1-phenylpropan-2-amine
 9826  C18H23NO  269.381
 InChI=1S/C18H23NO/c1-15(13-16-7-5-4-6-8-16)19(2)14-17-9-11-18(20-3)12-10-17/h4-12,15H,13-14H2,1-3H3
 FJSDDDQTJLJQKC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(cc1)CN(C(Cc1ccccc1)C)C