5-Me-iso-DMT
N,N-Dimethyl-2-(5-methyl-1H-indol-1-yl)ethan-1-amine
 9781 C13H18N2 202.295
 InChI=1S/C13H18N2/c1-11-4-5-13-12(10-11)6-7-15(13)9-8-14(2)3/h4-7,10H,8-9H2,1-3H3
 PQMAYIXYIYVYLM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCn1ccc2c1ccc(c2)C)C