6-Me-iso-DMT
N,N-Dimethyl-2-(6-methyl-1H-indol-1-yl)ethan-1-amine
 9780 C13H18N2 202.295
 InChI=1S/C13H18N2/c1-11-4-5-12-6-7-15(13(12)10-11)9-8-14(2)3/h4-7,10H,8-9H2,1-3H3
 ZAXRPTWZFOWFLD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCn1ccc2c1cc(C)cc2)C