7-Me-iso-DMT
N,N-Dimethyl-2-(7-methyl-1H-indol-1-yl)ethan-1-amine
 9779 C13H18N2 202.295
 InChI=1S/C13H18N2/c1-11-5-4-6-12-7-8-15(13(11)12)10-9-14(2)3/h4-8H,9-10H2,1-3H3
 DVGPCBBZUODSFU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCn1ccc2c1c(C)ccc2)C