6-MeO-iso-DMT
2-(6-Methoxy-1H-indol-1-yl)-N,N-dimethylethan-1-amine
 9777  C13H18N2O  218.295
 InChI=1S/C13H18N2O/c1-14(2)8-9-15-7-6-11-4-5-12(16-3)10-13(11)15/h4-7,10H,8-9H2,1-3H3
 VIEWFQAHIRFETA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc2c(c1)n(CCN(C)C)cc2