2,3-Dihydro-iso-DMT
2-(2,3-Dihydro-1H-indol-1-yl)-N,N-dimethylethan-1-amine
 9775  C12H18N2  190.285
 InChI=1S/C12H18N2/c1-13(2)9-10-14-8-7-11-5-3-4-6-12(11)14/h3-6H,7-10H2,1-2H3
 BNAWSOWKSSIPGW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCN1CCc2c1cccc2)C