4-Carboxymethamphetamine
4-[2-(Methylamino)propyl]benzoic acid
 9735 C11H15NO2 193.242
 InChI=1S/C11H15NO2/c1-8(12-2)7-9-3-5-10(6-4-9)11(13)14/h3-6,8,12H,7H2,1-2H3,(H,13,14)
 XINBBMPRWCDZQY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1ccc(cc1)C(=O)O)C