4-(Hydroxymethyl)amphetamine-NBOH
[4-(2-{[(2-Methoxyphenyl)methyl]amino}propyl)phenyl]methanol
 9733  C18H23NO2  285.381
 InChI=1S/C18H23NO2/c1-14(11-15-7-9-16(13-20)10-8-15)19-12-17-5-3-4-6-18(17)21-2/h3-10,14,19-20H,11-13H2,1-2H3
 LDTRCRMBAXHHBN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccccc1CNC(Cc1ccc(cc1)CO)C