1-{2-[2-(Cyclopropylmethoxy)-5-fluorophenyl]cyclopropyl}methanamine
 9669 C14H18FNO 235.297
 InChI=1S/C14H18FNO/c15-11-3-4-14(17-8-9-1-2-9)13(6-11)12-5-10(12)7-16/h3-4,6,9-10,12H,1-2,5,7-8,16H2
 PEJDRJDQIFVYTC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC1CC1c1cc(F)ccc1OCC1CC1