WAY-163909
1,2,3,4,8,9,10,10a-Octahydro-7bH-cyclopenta[b][1,4]diazepino[6,7,1-hi]indole
 9667  C14H18N2  214.306
 InChI=1S/C14H18N2/c1-3-10-9-15-7-8-16-13-6-2-4-11(13)12(5-1)14(10)16/h1,3,5,11,13,15H,2,4,6-9H2
 XOSKJKGKWRIMGV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C1CC2C(C1)c1c3N2CCNCc3ccc1