N-{[2-(5-Fluoro-2-methoxyphenyl)cyclopropyl]methyl}cyclopropanamine
 9616 C14H18FNO 235.297
 InChI=1S/C14H18FNO/c1-17-14-5-2-10(15)7-13(14)12-6-9(12)8-16-11-3-4-11/h2,5,7,9,11-12,16H,3-4,6,8H2,1H3
 LDVPNUWMRHGCRP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(cc1C1CC1CNC1CC1)F