3-Methylhydrastinine
6,7-Dimethyl-5,6,7,8-tetrahydro-2H-[1,3]dioxolo[4,5-g]isoquinolin-5-ol
 9604 C12H15NO3 221.252
 InChI=1S/C12H15NO3/c1-7-3-8-4-10-11(16-6-15-10)5-9(8)12(14)13(7)2/h4-5,7,12,14H,3,6H2,1-2H3
 NUVNHRHVMLZIIV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC1Cc2cc3OCOc3cc2C(N1C)O