α-Et-DIMETH
N,N-Dimethyl-1-phenylbutan-2-amine
 9585 C12H19N 177.286
 InChI=1S/C12H19N/c1-4-12(13(2)3)10-11-8-6-5-7-9-11/h5-9,12H,4,10H2,1-3H3
 UCEMLHMTZWCTKW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(N(C)C)Cc1ccccc1