α-MT-NPI
N-[1-(1H-Indol-3-yl)propan-2-yl]propan-2-imine
 9583  C14H18N2  214.306
 InChI=1S/C14H18N2/c1-10(2)16-11(3)8-12-9-15-14-7-5-4-6-13(12)14/h4-7,9,11,15H,8H2,1-3H3
 LPGJEOLIGBXIRD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(=NC(Cc1c[nH]c2c1cccc2)C)C