2-Hydroxy-5-[2-(methylamino)propyl]cyclohexa-2,5-diene-1,4-dione
 9568 C10H13NO3 195.215
 InChI=1S/C10H13NO3/c1-6(11-2)3-7-4-9(13)10(14)5-8(7)12/h4-6,11,14H,3H2,1-2H3
 GBDFGERSTBUIQW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(NC)CC1=CC(=O)C(=CC1=O)O