4-Carboxydihydro-mephedrone
4-[1-Hydroxy-2-(methylamino)propyl]benzoic acid
 9567 C11H15NO3 209.242
 InChI=1S/C11H15NO3/c1-7(12-2)10(13)8-3-5-9(6-4-8)11(14)15/h3-7,10,12-13H,1-2H3,(H,14,15)
 SNTGPLUTLQJSDY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(C(c1ccc(cc1)C(=O)O)O)C