Hydroxytolyl-mephedrone
1-[4-(Hydroxymethyl)phenyl]-2-(methylamino)propan-1-one
 9564 C11H15NO2 193.242
 InChI=1S/C11H15NO2/c1-8(12-2)11(14)10-5-3-9(7-13)4-6-10/h3-6,8,12-13H,7H2,1-2H3
 WCOUDJHDLOKVES-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 OCc1ccc(cc1)C(=O)C(NC)C