2-(1,6,7,8-Tetrahydropyrano[2,3-f]indol-3-yl)ethan-1-amine
 9533  C13H16N2O  216.279
 InChI=1S/C13H16N2O/c14-4-3-10-8-15-12-6-9-2-1-5-16-13(9)7-11(10)12/h6-8,15H,1-5,14H2
 DEXGNJZJOGJCIP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c[nH]c2c1cc1OCCCc1c2