3-Bromotyramine
2-(3-Bromo-4-methoxyphenyl)ethan-1-amine
 9463  C9H12BrNO  230.102
 InChI=1S/C9H12BrNO/c1-12-9-3-2-7(4-5-11)6-8(9)10/h2-3,6H,4-5,11H2,1H3
 JHVALSRTUOVNLL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(c(c1)Br)OC