4-Ethoxy-2,6-dimethyl-β-nitrostyrene
5-Ethoxy-1,3-dimethyl-2-[(E)-2-nitroethenyl]benzene
 9382 C12H15NO3 221.252
 InChI=1S/C12H15NO3/c1-4-16-11-7-9(2)12(10(3)8-11)5-6-13(14)15/h5-8H,4H2,1-3H3/b6-5+
 RRRIHHPVHLADOR-AATRIKPKSA-N This stereoisomer Any stereoisomer
 CCOc1cc(C)c(c(c1)C)/C=C/N(=O)=O