2,4-Diethoxy-6-methyl-β-nitrostyrene
1,5-Diethoxy-3-methyl-2-[(E)-2-nitroethenyl]benzene
 9379  C13H17NO4  251.278
 InChI=1S/C13H17NO4/c1-4-17-11-8-10(3)12(6-7-14(15)16)13(9-11)18-5-2/h6-9H,4-5H2,1-3H3/b7-6+
 FKUQVZUOBOWEKY-VOTSOKGWSA-N This stereoisomer Any stereoisomer
 CCOc1cc(OCC)cc(c1/C=C/N(=O)=O)C