Cyclohexyl-MDMA
2-(2H-1,3-Benzodioxol-5-yl)-1-cyclohexyl-N-methylethan-1-amine
 9325 C16H23NO2 261.359
 InChI=1S/C16H23NO2/c1-17-14(13-5-3-2-4-6-13)9-12-7-8-15-16(10-12)19-11-18-15/h7-8,10,13-14,17H,2-6,9,11H2,1H3
 HYQWCBLZQBHRDH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(C1CCCCC1)Cc1ccc2c(c1)OCO2