Mephedrone-BOC
tert-Butyl methyl[1-(4-methylphenyl)-1-oxopropan-2-yl]carbamate
 9300  C16H23NO3  277.359
 InChI=1S/C16H23NO3/c1-11-7-9-13(10-8-11)14(18)12(2)17(6)15(19)20-16(3,4)5/h7-10,12H,1-6H3
 KDCYAFSHFNXDRF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Cc1ccc(cc1)C(=O)C(N(C(=O)OC(C)(C)C)C)C