R-1388
Ethyl 1-{3-[3-(dimethylamino)phenyl]-3-oxopropyl}-4-phenylpiperidine-4-carboxylate
 9288 C25H32N2O3 408.533
 InChI=1S/C25H32N2O3/c1-4-30-24(29)25(21-10-6-5-7-11-21)14-17-27(18-15-25)16-13-23(28)20-9-8-12-22(19-20)26(2)3/h5-12,19H,4,13-18H2,1-3H3
 IUFGTPUTWNRIRE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOC(=O)C1(CCN(CC1)CCC(=O)c1cccc(c1)N(C)C)c1ccccc1