3-Methyl-1-(2-phenylethyl)-4-(pyridin-2-yl)piperidin-4-yl propanoate
 9163 C22H28N2O2 352.47
 InChI=1S/C22H28N2O2/c1-3-21(25)26-22(20-11-7-8-14-23-20)13-16-24(17-18(22)2)15-12-19-9-5-4-6-10-19/h4-11,14,18H,3,12-13,15-17H2,1-2H3
 OQJJZHWCBCTWAF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(=O)OC1(CCN(CC1C)CCc1ccccc1)c1ccccn1