Ethyl 1-methyl-4-(2-methylphenyl)piperidine-4-carboxylate
 9157 C16H23NO2 261.359
 InChI=1S/C16H23NO2/c1-4-19-15(18)16(9-11-17(3)12-10-16)14-8-6-5-7-13(14)2/h5-8H,4,9-12H2,1-3H3
 GMXFOMWALFJOAH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOC(=O)C1(CCN(CC1)C)c1ccccc1C