1-Phenyl-N-{3-[(propan-2-yl)oxy]propyl}cyclohexan-1-amine
 9110 C18H29NO 275.429
 Arylcycloalkylamine
 InChI=1S/C18H29NO/c1-16(2)20-15-9-14-19-18(12-7-4-8-13-18)17-10-5-3-6-11-17/h3,5-6,10-11,16,19H,4,7-9,12-15H2,1-2H3
 RTFQNHLLQTXQHR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(OCCCNC1(CCCCC1)c1ccccc1)C