2-EtO-α-Et-PEA
1-(2-Ethoxyphenyl)butan-2-amine
 9022 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-3-11(13)9-10-7-5-6-8-12(10)14-4-2/h5-8,11H,3-4,9,13H2,1-2H3
 POLIVELFELHZAO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1ccccc1CC(CC)N