4-MeO-N,α,2-Me-PEA
1-(4-Methoxy-2-methylphenyl)-N-methylpropan-2-amine
 9002 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-9-7-12(14-4)6-5-11(9)8-10(2)13-3/h5-7,10,13H,8H2,1-4H3
 DEHDFTSIHRYOMK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1ccc(cc1C)OC)C