5-MeO-N,α,2-Me-PEA
1-(5-Methoxy-2-methylphenyl)-N-methylpropan-2-amine
 9001 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-9-5-6-12(14-4)8-11(9)7-10(2)13-3/h5-6,8,10,13H,7H2,1-4H3
 XPEWUGUAJUUMDC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1cc(OC)ccc1C)C