3-MeO-N,α,5-Me-PEA
1-(3-Methoxy-5-methylphenyl)-N-methylpropan-2-amine
 9000 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-9-5-11(7-10(2)13-3)8-12(6-9)14-4/h5-6,8,10,13H,7H2,1-4H3
 RWBBTSKMHTXOCK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1cc(C)cc(c1)OC)C