α-Et-3-MeO-4-Me-PEA
1-(3-Methoxy-4-methylphenyl)butan-2-amine
 8988 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-4-11(13)7-10-6-5-9(2)12(8-10)14-3/h5-6,8,11H,4,7,13H2,1-3H3
 SZVGOUACXMAOSW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(Cc1ccc(c(c1)OC)C)N