α-Et-2-MeO-4-Me-PEA
1-(2-Methoxy-4-methylphenyl)butan-2-amine
 8967 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-4-11(13)8-10-6-5-9(2)7-12(10)14-3/h5-7,11H,4,8,13H2,1-3H3
 FUSFLXFFXUOYSO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(Cc1ccc(cc1OC)C)N