N-Et-2-MeO-4-Me-PEA
N-Ethyl-2-(2-methoxy-4-methylphenyl)ethan-1-amine
 8965 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-4-13-8-7-11-6-5-10(2)9-12(11)14-3/h5-6,9,13H,4,7-8H2,1-3H3
 QTSLZDWWMQAWTC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNCCc1ccc(cc1OC)C