4-OMePPP
1-[1-(4-Methoxyphenyl)propan-2-yl]piperazine
 8914  C14H22N2O  234.337
 InChI=1S/C14H22N2O/c1-12(16-9-7-15-8-10-16)11-13-3-5-14(17-2)6-4-13/h3-6,12,15H,7-11H2,1-2H3
 SEAQUCGEFKPCKM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(cc1)CC(N1CCNCC1)C