3-OMePPP
1-[1-(3-Methoxyphenyl)propan-2-yl]piperazine
 8913  C14H22N2O  234.337
 InChI=1S/C14H22N2O/c1-12(16-8-6-15-7-9-16)10-13-4-3-5-14(11-13)17-2/h3-5,11-12,15H,6-10H2,1-2H3
 RAKQEOWMZMYSPT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cccc(c1)CC(N1CCNCC1)C