2-OMePPP
1-[1-(2-Methoxyphenyl)propan-2-yl]piperazine
 8912  C14H22N2O  234.337
 InChI=1S/C14H22N2O/c1-12(16-9-7-15-8-10-16)11-13-5-3-4-6-14(13)17-2/h3-6,12,15H,7-11H2,1-2H3
 QJJQIHVTRNBCBC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccccc1CC(N1CCNCC1)C