3,5-DMPP
1-(3,5-Dimethylphenyl)piperazine
 8881  C12H18N2  190.285
 InChI=1S/C12H18N2/c1-10-7-11(2)9-12(8-10)14-5-3-13-4-6-14/h7-9,13H,3-6H2,1-2H3
 RBSSPJDOINFUCR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Cc1cc(cc(c1)C)N1CCNCC1