3,4-DMPP
1-(3,4-Dimethylphenyl)piperazine
 8880  C12H18N2  190.285
 InChI=1S/C12H18N2/c1-10-3-4-12(9-11(10)2)14-7-5-13-6-8-14/h3-4,9,13H,5-8H2,1-2H3
 SFLNVAVCCYTHCQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Cc1ccc(cc1C)N1CCNCC1