2,6-DMPP
1-(2,6-Dimethylphenyl)piperazine
 8879  C12H18N2  190.285
 InChI=1S/C12H18N2/c1-10-4-3-5-11(2)12(10)14-8-6-13-7-9-14/h3-5,13H,6-9H2,1-2H3
 JDVUSTNITSGJOH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Cc1cccc(c1N1CCNCC1)C