2,5-DMPP
1-(2,5-Dimethylphenyl)piperazine
 8878  C12H18N2  190.285
 InChI=1S/C12H18N2/c1-10-3-4-11(2)12(9-10)14-7-5-13-6-8-14/h3-4,9,13H,5-8H2,1-2H3
 YRIFWVMRUFKWLM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Cc1ccc(cc1N1CCNCC1)C