2,4-DMPP
1-(2,4-Dimethylphenyl)piperazine
 8877  C12H18N2  190.285
 InChI=1S/C12H18N2/c1-10-3-4-12(11(2)9-10)14-7-5-13-6-8-14/h3-4,9,13H,5-8H2,1-2H3
 RUIMBVCRNZHCRQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Cc1ccc(c(c1)C)N1CCNCC1