BM-4-MMA
N-Methyl-3-(4-methylphenyl)butan-2-amine
 8660 C12H19N 177.286
 InChI=1S/C12H19N/c1-9-5-7-12(8-6-9)10(2)11(3)13-4/h5-8,10-11,13H,1-4H3
 ZMQRKOOZEPRKNP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(C(c1ccc(cc1)C)C)C