4-Bromoethylphenidate
Ethyl (4-bromophenyl)(piperidin-2-yl)acetate
 8647 C15H20BrNO2 326.229
 InChI=1S/C15H20BrNO2/c1-2-19-15(18)14(13-5-3-4-10-17-13)11-6-8-12(16)9-7-11/h6-9,13-14,17H,2-5,10H2,1H3
 AWPCZFWQPBZWAF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOC(=O)C(c1ccc(cc1)Br)C1CCCCN1