3-MPBP
1-(3-Methylphenyl)-2-(pyrrolidin-1-yl)butan-1-one
 8608 C15H21NO 231.333
 InChI=1S/C15H21NO/c1-3-14(16-9-4-5-10-16)15(17)13-8-6-7-12(2)11-13/h6-8,11,14H,3-5,9-10H2,1-2H3
 GHUHXBRSGNJMFC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(C(=O)c1cccc(c1)C)N1CCCC1