4F-PBP
1-(4-Fluorophenyl)-2-(pyrrolidin-1-yl)butan-1-one
 8607 C14H18FNO 235.297
 InChI=1S/C14H18FNO/c1-2-13(16-9-3-4-10-16)14(17)11-5-7-12(15)8-6-11/h5-8,13H,2-4,9-10H2,1H3
 BYMOJFLMEMTDDX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(C(=O)c1ccc(cc1)F)N1CCCC1