2,4-DMPPP
1-(2,4-Dimethylphenyl)-2-(pyrrolidin-1-yl)propan-1-one
 8606 C15H21NO 231.333
 InChI=1S/C15H21NO/c1-11-6-7-14(12(2)10-11)15(17)13(3)16-8-4-5-9-16/h6-7,10,13H,4-5,8-9H2,1-3H3
 QBFQLEVWHCQDIR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Cc1ccc(c(c1)C)C(=O)C(N1CCCC1)C