PPBO
1-Phenyl-2-(piperidin-1-yl)butan-1-one
 8597 C15H21NO 231.333
 InChI=1S/C15H21NO/c1-2-14(16-11-7-4-8-12-16)15(17)13-9-5-3-6-10-13/h3,5-6,9-10,14H,2,4,7-8,11-12H2,1H3
 VFLPICJWFQLLSY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(C(=O)c1ccccc1)N1CCCCC1