bk-IMP
1-(2,3-Dihydro-1H-inden-5-yl)-2-(methylamino)propan-1-one
 8568 C13H17NO 203.28
 InChI=1S/C13H17NO/c1-9(14-2)13(15)12-7-6-10-4-3-5-11(10)8-12/h6-9,14H,3-5H2,1-2H3
 FHGNUKAARRYOMM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(C(=O)c1ccc2c(c1)CCC2)C