bk-2C-D
2-Amino-1-(2,5-dimethoxy-4-methylphenyl)ethan-1-one
 8553 C11H15NO3 209.242
 InChI=1S/C11H15NO3/c1-7-4-11(15-3)8(9(13)6-12)5-10(7)14-2/h4-5H,6,12H2,1-3H3
 RMYSODBYTXVKOO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C(=O)CN)c(cc1C)OC